C26H27N3O4 — CID 110232994
4-(2-ethoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide (PubChem CID 110232994) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-(2-ethoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | 4-(2-ethoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 110232994 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 4-(2-ethoxybenzoyl)-2-[(3-pyridin-4-ylphenyl)methyl]morpholine-2-carboxamide |
| SMILES | CCOc1ccccc1C(=O)N1CCOC(Cc2cccc(-c3ccncc3)c2)(C(N)=O)C1 |
| InChI | InChI=1S/C26H27N3O4/c1-2-32-23-9-4-3-8-22(23)24(30)29-14-15-33-26(18-29,25(27)31)17-19-6-5-7-21(16-19)20-10-12-28-13-11-20/h3-13,16H,2,14-15,17-18H2,1H3,(H2,27,31) |
| InChIKey | MPGPKTSFNMVKAB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |