C24H24N2O4S — CID 92575352
(2S)-4-(2-phenoxyacetyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide (PubChem CID 92575352) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is (2S)-4-(2-phenoxyacetyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-(2-phenoxyacetyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 92575352 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (2S)-4-(2-phenoxyacetyl)-2-[(4-thiophen-2-ylphenyl)methyl]morpholine-2-carboxamide |
| SMILES | NC(=O)[C@]1(Cc2ccc(-c3cccs3)cc2)CN(C(=O)COc2ccccc2)CCO1 |
| InChI | InChI=1S/C24H24N2O4S/c25-23(28)24(15-18-8-10-19(11-9-18)21-7-4-14-31-21)17-26(12-13-30-24)22(27)16-29-20-5-2-1-3-6-20/h1-11,14H,12-13,15-17H2,(H2,25,28)/t24-/m0/s1 |
| InChIKey | DLQUJAKUOLKKGL-DEOSSOPVSA-N |
| XLogP | 3.12 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |