C26H27N3O2S — CID 110232433
N-prop-2-enyl-1-(pyridine-4-carbonyl)-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 110232433) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-prop-2-enyl-1-(pyridine-4-carbonyl)-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-prop-2-enyl-1-(pyridine-4-carbonyl)-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 110232433 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-prop-2-enyl-1-(pyridine-4-carbonyl)-3-[(4-thiophen-2-ylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | C=CCNC(=O)C1(Cc2ccc(-c3cccs3)cc2)CCCN(C(=O)c2ccncc2)C1 |
| InChI | InChI=1S/C26H27N3O2S/c1-2-13-28-25(31)26(18-20-6-8-21(9-7-20)23-5-3-17-32-23)12-4-16-29(19-26)24(30)22-10-14-27-15-11-22/h2-3,5-11,14-15,17H,1,4,12-13,16,18-19H2,(H,28,31) |
| InChIKey | FZDCXHJYODPSAN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|