C23H32N4O3 — CID 155983035
2-[4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-N-propan-2-ylquinoline-4-carboxamide (PubChem CID 155983035) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-N-propan-2-ylquinoline-4-carboxamide.
| Compound Name | 2-[4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-N-propan-2-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 155983035 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 2-[4-[2-(diethylamino)-2-oxoethyl]morpholin-2-yl]-N-propan-2-ylquinoline-4-carboxamide |
| SMILES | CCN(CC)C(=O)CN1CCOC(c2cc(C(=O)NC(C)C)c3ccccc3n2)C1 |
| InChI | InChI=1S/C23H32N4O3/c1-5-27(6-2)22(28)15-26-11-12-30-21(14-26)20-13-18(23(29)24-16(3)4)17-9-7-8-10-19(17)25-20/h7-10,13,16,21H,5-6,11-12,14-15H2,1-4H3,(H,24,29) |
| InChIKey | JZYOPMJLVXNEMT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |