C21H23N5O2 — CID 92638356
N-propan-2-yl-2-[(2S)-4-pyrimidin-2-ylmorpholin-2-yl]quinoline-4-carboxamide (PubChem CID 92638356) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-propan-2-yl-2-[(2S)-4-pyrimidin-2-ylmorpholin-2-yl]quinoline-4-carboxamide.
| Compound Name | N-propan-2-yl-2-[(2S)-4-pyrimidin-2-ylmorpholin-2-yl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 92638356 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-propan-2-yl-2-[(2S)-4-pyrimidin-2-ylmorpholin-2-yl]quinoline-4-carboxamide |
| SMILES | CC(C)NC(=O)c1cc([C@@H]2CN(c3ncccn3)CCO2)nc2ccccc12 |
| InChI | InChI=1S/C21H23N5O2/c1-14(2)24-20(27)16-12-18(25-17-7-4-3-6-15(16)17)19-13-26(10-11-28-19)21-22-8-5-9-23-21/h3-9,12,14,19H,10-11,13H2,1-2H3,(H,24,27)/t19-/m0/s1 |
| InChIKey | VYTGMJWDSIQDDG-IBGZPJMESA-N |
| XLogP | 2.74 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |