C22H24N2O4 — CID 155986041
9-(3-methoxybenzoyl)-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one (PubChem CID 155986041) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 9-(3-methoxybenzoyl)-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one.
| Compound Name | 9-(3-methoxybenzoyl)-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 155986041 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 9-(3-methoxybenzoyl)-4-phenyl-1-oxa-4,9-diazaspiro[5.5]undecan-3-one |
| SMILES | COc1cccc(C(=O)N2CCC3(CC2)CN(c2ccccc2)C(=O)CO3)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-27-19-9-5-6-17(14-19)21(26)23-12-10-22(11-13-23)16-24(20(25)15-28-22)18-7-3-2-4-8-18/h2-9,14H,10-13,15-16H2,1H3 |
| InChIKey | HGTATQALCDCMLI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |