C27H28ClN3O2 — CID 155986592
(4-benzyloxan-4-yl)-[2-[2-(4-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]methanone (PubChem CID 155986592) has the molecular formula C27H28ClN3O2 and a molecular weight of 461.99 g/mol. Its IUPAC name is (4-benzyloxan-4-yl)-[2-[2-(4-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]methanone.
| Compound Name | (4-benzyloxan-4-yl)-[2-[2-(4-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 155986592 |
| Molecular Formula | C27H28ClN3O2 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (4-benzyloxan-4-yl)-[2-[2-(4-chlorophenyl)pyrimidin-4-yl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCCC1c1ccnc(-c2ccc(Cl)cc2)n1)C1(Cc2ccccc2)CCOCC1 |
| InChI | InChI=1S/C27H28ClN3O2/c28-22-10-8-21(9-11-22)25-29-15-12-23(30-25)24-7-4-16-31(24)26(32)27(13-17-33-18-14-27)19-20-5-2-1-3-6-20/h1-3,5-6,8-12,15,24H,4,7,13-14,16-19H2 |
| InChIKey | CISFBYZWTKLTCE-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |