C26H26FN3O — CID 129453255
[1-(2-fluorophenyl)cyclopentyl]-[(2R)-2-(2-phenylpyrimidin-4-yl)pyrrolidin-1-yl]methanone (PubChem CID 129453255) has the molecular formula C26H26FN3O and a molecular weight of 415.51 g/mol. Its IUPAC name is [1-(2-fluorophenyl)cyclopentyl]-[(2R)-2-(2-phenylpyrimidin-4-yl)pyrrolidin-1-yl]methanone.
| Compound Name | [1-(2-fluorophenyl)cyclopentyl]-[(2R)-2-(2-phenylpyrimidin-4-yl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 129453255 |
| Molecular Formula | C26H26FN3O |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | [1-(2-fluorophenyl)cyclopentyl]-[(2R)-2-(2-phenylpyrimidin-4-yl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCC[C@@H]1c1ccnc(-c2ccccc2)n1)C1(c2ccccc2F)CCCC1 |
| InChI | InChI=1S/C26H26FN3O/c27-21-12-5-4-11-20(21)26(15-6-7-16-26)25(31)30-18-8-13-23(30)22-14-17-28-24(29-22)19-9-2-1-3-10-19/h1-5,9-12,14,17,23H,6-8,13,15-16,18H2/t23-/m1/s1 |
| InChIKey | ABEFWUNNSTXSES-HSZRJFAPSA-N |
| XLogP | 5.46 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |