C31H36ClN3O6 — CID 155989672
(2S)-2-[[(2S)-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 155989672) has the molecular formula C31H36ClN3O6 and a molecular weight of 582.10 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 155989672 |
| Molecular Formula | C31H36ClN3O6 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-4-methylpentanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)c1cc(Cl)ccc1OCCNCc1ccccc1)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C31H36ClN3O6/c1-20(2)16-26(30(38)35-27(31(39)40)17-21-8-11-24(36)12-9-21)34-29(37)25-18-23(32)10-13-28(25)41-15-14-33-19-22-6-4-3-5-7-22/h3-13,18,20,26-27,33,36H,14-17,19H2,1-2H3,(H,34,37)(H,35,38)(H,39,40)/t26-,27-/m0/s1 |
| InChIKey | YMKDIOSTTLVVHH-SVBPBHIXSA-N |
| XLogP | 4.17 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|