C25H31ClN4O7 — CID 155989679
(2S,3R)-2-[[(2S)-5-amino-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-5-oxopentanoyl]amino]-3-hydroxybutanoic acid (PubChem CID 155989679) has the molecular formula C25H31ClN4O7 and a molecular weight of 535.00 g/mol. Its IUPAC name is (2S,3R)-2-[[(2S)-5-amino-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-5-oxopentanoyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[(2S)-5-amino-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-5-oxopentanoyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 155989679 |
| Molecular Formula | C25H31ClN4O7 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (2S,3R)-2-[[(2S)-5-amino-2-[[2-[2-(benzylamino)ethoxy]-5-chlorobenzoyl]amino]-5-oxopentanoyl]amino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)c1cc(Cl)ccc1OCCNCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H31ClN4O7/c1-15(31)22(25(35)36)30-24(34)19(8-10-21(27)32)29-23(33)18-13-17(26)7-9-20(18)37-12-11-28-14-16-5-3-2-4-6-16/h2-7,9,13,15,19,22,28,31H,8,10-12,14H2,1H3,(H2,27,32)(H,29,33)(H,30,34)(H,35,36)/t15-,19+,22+/m1/s1 |
| InChIKey | UYGGUFVDADNZCW-MPHOGZCYSA-N |
| XLogP | 0.82 |
| TPSA | 180.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|