C25H38N6O2 — CID 155991527
3-methyl-1-[6-(2-methylpropyl)-9-[2-(1,2,4-triazol-1-yl)acetyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]butan-1-one (PubChem CID 155991527) has the molecular formula C25H38N6O2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 3-methyl-1-[6-(2-methylpropyl)-9-[2-(1,2,4-triazol-1-yl)acetyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]butan-1-one.
| Compound Name | 3-methyl-1-[6-(2-methylpropyl)-9-[2-(1,2,4-triazol-1-yl)acetyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]butan-1-one |
|---|---|
| PubChem CID | 155991527 |
| Molecular Formula | C25H38N6O2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | 3-methyl-1-[6-(2-methylpropyl)-9-[2-(1,2,4-triazol-1-yl)acetyl]-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-2-yl]butan-1-one |
| SMILES | CC(C)CC(=O)N1CCCN(CC(C)C)CCN(C(=O)Cn2cncn2)Cc2ccccc21 |
| InChI | InChI=1S/C25H38N6O2/c1-20(2)14-24(32)31-11-7-10-28(15-21(3)4)12-13-29(16-22-8-5-6-9-23(22)31)25(33)17-30-19-26-18-27-30/h5-6,8-9,18-21H,7,10-17H2,1-4H3 |
| InChIKey | NWHKQZKGDIGWAS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 74.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |