C33H45N5O2 — CID 133071097
1-[6-(2-methylpropyl)-2-(2-phenylacetyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one (PubChem CID 133071097) has the molecular formula C33H45N5O2 and a molecular weight of 543.76 g/mol. Its IUPAC name is 1-[6-(2-methylpropyl)-2-(2-phenylacetyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one.
| Compound Name | 1-[6-(2-methylpropyl)-2-(2-phenylacetyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one |
|---|---|
| PubChem CID | 133071097 |
| Molecular Formula | C33H45N5O2 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.36 |
| IUPAC Name | 1-[6-(2-methylpropyl)-2-(2-phenylacetyl)-2,6,9-triazabicyclo[9.4.0]pentadeca-1(15),11,13-trien-9-yl]-3-(1,3,5-trimethylpyrazol-4-yl)propan-1-one |
| SMILES | Cc1nn(C)c(C)c1CCC(=O)N1CCN(CC(C)C)CCCN(C(=O)Cc2ccccc2)c2ccccc2C1 |
| InChI | InChI=1S/C33H45N5O2/c1-25(2)23-36-18-11-19-38(33(40)22-28-12-7-6-8-13-28)31-15-10-9-14-29(31)24-37(21-20-36)32(39)17-16-30-26(3)34-35(5)27(30)4/h6-10,12-15,25H,11,16-24H2,1-5H3 |
| InChIKey | KMHUJSVZSZZHCG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |