C21H23ClFNO3 — CID 155991715
2-(2-chloro-6-fluorophenyl)-1-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]ethanone (PubChem CID 155991715) has the molecular formula C21H23ClFNO3 and a molecular weight of 391.87 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-1-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]ethanone.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-1-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 155991715 |
| Molecular Formula | C21H23ClFNO3 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-1-[4-hydroxy-4-(phenoxymethyl)azepan-1-yl]ethanone |
| SMILES | O=C(Cc1c(F)cccc1Cl)N1CCCC(O)(COc2ccccc2)CC1 |
| InChI | InChI=1S/C21H23ClFNO3/c22-18-8-4-9-19(23)17(18)14-20(25)24-12-5-10-21(26,11-13-24)15-27-16-6-2-1-3-7-16/h1-4,6-9,26H,5,10-15H2 |
| InChIKey | QQSHOPWHXITNJI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |