C28H31ClN2O2 — CID 155994242
2-(2-chlorophenyl)-1-[(12S)-12-(2-methylpropyl)-10-oxa-2,13-diazatricyclo[13.4.0.04,9]nonadeca-1(19),4,6,8,15,17-hexaen-13-yl]ethanone (PubChem CID 155994242) has the molecular formula C28H31ClN2O2 and a molecular weight of 463.02 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-1-[(12S)-12-(2-methylpropyl)-10-oxa-2,13-diazatricyclo[13.4.0.04,9]nonadeca-1(19),4,6,8,15,17-hexaen-13-yl]ethanone.
| Compound Name | 2-(2-chlorophenyl)-1-[(12S)-12-(2-methylpropyl)-10-oxa-2,13-diazatricyclo[13.4.0.04,9]nonadeca-1(19),4,6,8,15,17-hexaen-13-yl]ethanone |
|---|---|
| PubChem CID | 155994242 |
| Molecular Formula | C28H31ClN2O2 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | 2-(2-chlorophenyl)-1-[(12S)-12-(2-methylpropyl)-10-oxa-2,13-diazatricyclo[13.4.0.04,9]nonadeca-1(19),4,6,8,15,17-hexaen-13-yl]ethanone |
| SMILES | CC(C)C[C@H]1COc2ccccc2CNc2ccccc2CN1C(=O)Cc1ccccc1Cl |
| InChI | InChI=1S/C28H31ClN2O2/c1-20(2)15-24-19-33-27-14-8-5-10-22(27)17-30-26-13-7-4-11-23(26)18-31(24)28(32)16-21-9-3-6-12-25(21)29/h3-14,20,24,30H,15-19H2,1-2H3/t24-/m0/s1 |
| InChIKey | PHAITABZLKZHOV-DEOSSOPVSA-N |
| XLogP | 6.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |