C19H34N2O2 — CID 155994689
1-[(4aR,9aR)-1-[(1-hydroxycycloheptyl)methyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]ethanone (PubChem CID 155994689) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-[(4aR,9aR)-1-[(1-hydroxycycloheptyl)methyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]ethanone.
| Compound Name | 1-[(4aR,9aR)-1-[(1-hydroxycycloheptyl)methyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]ethanone |
|---|---|
| PubChem CID | 155994689 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 1-[(4aR,9aR)-1-[(1-hydroxycycloheptyl)methyl]-3,4,4a,6,7,8,9,9a-octahydro-2H-pyrido[3,2-b]azepin-5-yl]ethanone |
| SMILES | CC(=O)N1CCCC[C@@H]2[C@H]1CCCN2CC1(O)CCCCCC1 |
| InChI | InChI=1S/C19H34N2O2/c1-16(22)21-14-7-4-9-17-18(21)10-8-13-20(17)15-19(23)11-5-2-3-6-12-19/h17-18,23H,2-15H2,1H3/t17-,18-/m1/s1 |
| InChIKey | GFYZYPKKFWLWQP-QZTJIDSGSA-N |
| XLogP | 2.94 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |