C15H17ClN2O2 — CID 155996966
(1R,2R,6S)-2-(4-chlorophenoxy)-6-imidazol-1-ylcyclohexan-1-ol (PubChem CID 155996966) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is (1R,2R,6S)-2-(4-chlorophenoxy)-6-imidazol-1-ylcyclohexan-1-ol.
| Compound Name | (1R,2R,6S)-2-(4-chlorophenoxy)-6-imidazol-1-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 155996966 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | (1R,2R,6S)-2-(4-chlorophenoxy)-6-imidazol-1-ylcyclohexan-1-ol |
| SMILES | O[C@H]1[C@H](Oc2ccc(Cl)cc2)CCC[C@@H]1n1ccnc1 |
| InChI | InChI=1S/C15H17ClN2O2/c16-11-4-6-12(7-5-11)20-14-3-1-2-13(15(14)19)18-9-8-17-10-18/h4-10,13-15,19H,1-3H2/t13-,14+,15+/m0/s1 |
| InChIKey | INMMFLRPMWGQPG-RRFJBIMHSA-N |
| XLogP | 3.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |