C30H40ClFN2O6 — CID 155997040
[(7R,11R,12R,13R)-6-(2-chlorobenzoyl)-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone (PubChem CID 155997040) has the molecular formula C30H40ClFN2O6 and a molecular weight of 579.11 g/mol. Its IUPAC name is [(7R,11R,12R,13R)-6-(2-chlorobenzoyl)-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(7R,11R,12R,13R)-6-(2-chlorobenzoyl)-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 155997040 |
| Molecular Formula | C30H40ClFN2O6 |
| Molecular Weight | 579.11 g/mol |
| Exact Mass | 578.26 |
| IUPAC Name | [(7R,11R,12R,13R)-6-(2-chlorobenzoyl)-12,13-dihydroxy-11-methoxy-7-(2-methylpropyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone |
| SMILES | CO[C@@H]1CN(C(=O)c2ccccc2F)C[C@@H](CC(C)C)N(C(=O)c2ccccc2Cl)CCCCOC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H40ClFN2O6/c1-20(2)16-21-17-33(29(37)23-11-5-7-13-25(23)32)18-27(39-3)28(36)26(35)19-40-15-9-8-14-34(21)30(38)22-10-4-6-12-24(22)31/h4-7,10-13,20-21,26-28,35-36H,8-9,14-19H2,1-3H3/t21-,26-,27-,28-/m1/s1 |
| InChIKey | XPCJCUPHLOTBIC-WWAFRDAFSA-N |
| XLogP | 4.03 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.11 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |