C27H40FN3O5S — CID 155997335
[(11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-(1,3-thiazol-4-ylmethyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone (PubChem CID 155997335) has the molecular formula C27H40FN3O5S and a molecular weight of 537.70 g/mol. Its IUPAC name is [(11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-(1,3-thiazol-4-ylmethyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-(1,3-thiazol-4-ylmethyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 155997335 |
| Molecular Formula | C27H40FN3O5S |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | [(11R,12R,13R)-12,13-dihydroxy-11-(3-methylbutoxy)-6-(1,3-thiazol-4-ylmethyl)-1-oxa-6,9-diazacyclotetradec-9-yl]-(2-fluorophenyl)methanone |
| SMILES | CC(C)CCO[C@@H]1CN(C(=O)c2ccccc2F)CCN(Cc2cscn2)CCCCOC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C27H40FN3O5S/c1-20(2)9-14-36-25-16-31(27(34)22-7-3-4-8-23(22)28)12-11-30(15-21-18-37-19-29-21)10-5-6-13-35-17-24(32)26(25)33/h3-4,7-8,18-20,24-26,32-33H,5-6,9-17H2,1-2H3/t24-,25-,26-/m1/s1 |
| InChIKey | GRMAVBKZWHVUIT-TWJOJJKGSA-N |
| XLogP | 3.19 |
| TPSA | 95.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |