C19H25FN2O5 — CID 155999595
4-(4-fluorophenyl)-8-[2-(2-methoxyethoxy)acetyl]-1-oxa-4,8-diazaspiro[5.5]undecan-3-one (PubChem CID 155999595) has the molecular formula C19H25FN2O5 and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-8-[2-(2-methoxyethoxy)acetyl]-1-oxa-4,8-diazaspiro[5.5]undecan-3-one.
| Compound Name | 4-(4-fluorophenyl)-8-[2-(2-methoxyethoxy)acetyl]-1-oxa-4,8-diazaspiro[5.5]undecan-3-one |
|---|---|
| PubChem CID | 155999595 |
| Molecular Formula | C19H25FN2O5 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-(4-fluorophenyl)-8-[2-(2-methoxyethoxy)acetyl]-1-oxa-4,8-diazaspiro[5.5]undecan-3-one |
| SMILES | COCCOCC(=O)N1CCCC2(C1)CN(c1ccc(F)cc1)C(=O)CO2 |
| InChI | InChI=1S/C19H25FN2O5/c1-25-9-10-26-11-17(23)21-8-2-7-19(13-21)14-22(18(24)12-27-19)16-5-3-15(20)4-6-16/h3-6H,2,7-14H2,1H3 |
| InChIKey | AUBGHSXIXWGSPH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|