C21H30O6 — CID 156012411
[(1R,2E,4S,5R,6R,10S)-4,6-diacetyloxy-3,11,11-trimethyl-7-methylidene-5-bicyclo[8.1.0]undec-2-enyl] acetate (PubChem CID 156012411) has the molecular formula C21H30O6 and a molecular weight of 378.50 g/mol. Its IUPAC name is [(1R,2E,4S,5R,6R,10S)-4,6-diacetyloxy-3,11,11-trimethyl-7-methylidene-5-bicyclo[8.1.0]undec-2-enyl] acetate.
| Compound Name | [(1R,2E,4S,5R,6R,10S)-4,6-diacetyloxy-3,11,11-trimethyl-7-methylidene-5-bicyclo[8.1.0]undec-2-enyl] acetate |
|---|---|
| PubChem CID | 156012411 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(1R,2E,4S,5R,6R,10S)-4,6-diacetyloxy-3,11,11-trimethyl-7-methylidene-5-bicyclo[8.1.0]undec-2-enyl] acetate |
| SMILES | C/C/1=C\[C@@H]2[C@@H](C2(C)C)CCC(=C)[C@H]([C@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C |
| InChI | InChI=1S/C21H30O6/c1-11-8-9-16-17(21(16,6)7)10-12(2)19(26-14(4)23)20(27-15(5)24)18(11)25-13(3)22/h10,16-20H,1,8-9H2,2-7H3/b12-10+/t16-,17+,18+,19-,20+/m0/s1 |
| InChIKey | XLLDUOVKRYWTKD-HQFZKZOTSA-N |
| XLogP | 2.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | 674 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|