C23H21F2N3O — CID 15604395
(1S,7S)-3-(2,4-difluorophenyl)-N-(1-phenylethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide (PubChem CID 15604395) has the molecular formula C23H21F2N3O and a molecular weight of 393.44 g/mol. Its IUPAC name is (1S,7S)-3-(2,4-difluorophenyl)-N-(1-phenylethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide.
| Compound Name | (1S,7S)-3-(2,4-difluorophenyl)-N-(1-phenylethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
|---|---|
| PubChem CID | 15604395 |
| Molecular Formula | C23H21F2N3O |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (1S,7S)-3-(2,4-difluorophenyl)-N-(1-phenylethyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboxamide |
| SMILES | CC(NC(=O)c1nn(-c2ccc(F)cc2F)c2c1[C@H]1CC[C@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C23H21F2N3O/c1-13(14-5-3-2-4-6-14)26-23(29)21-20-15-7-8-16(11-15)22(20)28(27-21)19-10-9-17(24)12-18(19)25/h2-6,9-10,12-13,15-16H,7-8,11H2,1H3,(H,26,29)/t13?,15-,16-/m0/s1 |
| InChIKey | YKIJZGLEOWQIIK-FMYDAXTQSA-N |
| XLogP | 5.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |