C16H15F2N3O — CID 140527099
methyl (1S,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboximidate (PubChem CID 140527099) has the molecular formula C16H15F2N3O and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl (1S,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboximidate.
| Compound Name | methyl (1S,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboximidate |
|---|---|
| PubChem CID | 140527099 |
| Molecular Formula | C16H15F2N3O |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | methyl (1S,7R)-3-(2,4-difluorophenyl)-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-diene-5-carboximidate |
| SMILES | [H]/N=C(\OC)c1nn(-c2ccc(F)cc2F)c2c1[C@@H]1CC[C@H]2C1 |
| InChI | InChI=1S/C16H15F2N3O/c1-22-16(19)14-13-8-2-3-9(6-8)15(13)21(20-14)12-5-4-10(17)7-11(12)18/h4-5,7-9,19H,2-3,6H2,1H3/b19-16-/t8-,9+/m1/s1 |
| InChIKey | LPUKCVTZHXQXPG-UNOMVFTKSA-N |
| XLogP | 3.49 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|