C30H33F3N2O3 — CID 15605152
6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-6-oxohexanoic acid (PubChem CID 15605152) has the molecular formula C30H33F3N2O3 and a molecular weight of 526.60 g/mol. Its IUPAC name is 6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-6-oxohexanoic acid.
| Compound Name | 6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 15605152 |
| Molecular Formula | C30H33F3N2O3 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 6-[(3S,4S)-3-[[[(1R)-1-naphthalen-1-ylethyl]amino]methyl]-4-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]-6-oxohexanoic acid |
| SMILES | C[C@@H](NC[C@H]1CN(C(=O)CCCCC(=O)O)C[C@@H]1c1cccc(C(F)(F)F)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H33F3N2O3/c1-20(25-13-7-9-21-8-2-3-12-26(21)25)34-17-23-18-35(28(36)14-4-5-15-29(37)38)19-27(23)22-10-6-11-24(16-22)30(31,32)33/h2-3,6-13,16,20,23,27,34H,4-5,14-15,17-19H2,1H3,(H,37,38)/t20-,23+,27-/m1/s1 |
| InChIKey | BRYAPZULRPVYSK-PCGJDWNTSA-N |
| XLogP | 6.40 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|