C21H24ClN5O4 — CID 15611199
(2R,3R,4S,5R)-2-[6-[[1-(3-chlorophenyl)cyclobutyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 15611199) has the molecular formula C21H24ClN5O4 and a molecular weight of 445.91 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-[[1-(3-chlorophenyl)cyclobutyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-[[1-(3-chlorophenyl)cyclobutyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 15611199 |
| Molecular Formula | C21H24ClN5O4 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-[[1-(3-chlorophenyl)cyclobutyl]methylamino]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cnc3c(NCC4(c5cccc(Cl)c5)CCC4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24ClN5O4/c22-13-4-1-3-12(7-13)21(5-2-6-21)9-23-18-15-19(25-10-24-18)27(11-26-15)20-17(30)16(29)14(8-28)31-20/h1,3-4,7,10-11,14,16-17,20,28-30H,2,5-6,8-9H2,(H,23,24,25)/t14-,16-,17-,20-/m1/s1 |
| InChIKey | WYAZTYYPDMFVCJ-WVSUBDOOSA-N |
| XLogP | 1.62 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |