C20H16N2O5 — CID 15617543
butyl 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylate (PubChem CID 15617543) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is butyl 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylate.
| Compound Name | butyl 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylate |
|---|---|
| PubChem CID | 15617543 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | butyl 1,5-dioxo-4H-pyrido[3,2-a]phenoxazine-3-carboxylate |
| SMILES | CCCCOC(=O)c1cc(=O)c2c3nc4ccccc4oc-3cc(=O)c2[nH]1 |
| InChI | InChI=1S/C20H16N2O5/c1-2-3-8-26-20(25)12-9-13(23)17-18(22-12)14(24)10-16-19(17)21-11-6-4-5-7-15(11)27-16/h4-7,9-10H,2-3,8H2,1H3,(H,22,23) |
| InChIKey | NUJCULMHVPUANG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|