C6H15Br2NO — CID 15617985
(3-bromo-2-hydroxypropyl)-trimethylazanium bromide (PubChem CID 15617985) has the molecular formula C6H15Br2NO and a molecular weight of 277.00 g/mol. Its IUPAC name is (3-bromo-2-hydroxypropyl)-trimethylazanium bromide.
| Compound Name | (3-bromo-2-hydroxypropyl)-trimethylazanium bromide |
|---|---|
| PubChem CID | 15617985 |
| Molecular Formula | C6H15Br2NO |
| Molecular Weight | 277.00 g/mol |
| Exact Mass | 274.95 |
| IUPAC Name | (3-bromo-2-hydroxypropyl)-trimethylazanium bromide |
| SMILES | C[N+](C)(C)CC(O)CBr.[Br-] |
| InChI | InChI=1S/C6H15BrNO.BrH/c1-8(2,3)5-6(9)4-7;/h6,9H,4-5H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OLVYOPBFTQXYON-UHFFFAOYSA-M |
| XLogP | -2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.00 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|