C13H10FN3OS — CID 15622567
5-amino-6-fluoro-3-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-one (PubChem CID 15622567) has the molecular formula C13H10FN3OS and a molecular weight of 275.31 g/mol. Its IUPAC name is 5-amino-6-fluoro-3-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-one.
| Compound Name | 5-amino-6-fluoro-3-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 15622567 |
| Molecular Formula | C13H10FN3OS |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 5-amino-6-fluoro-3-(pyridin-2-ylmethyl)-1,3-benzothiazol-2-one |
| SMILES | Nc1cc2c(cc1F)sc(=O)n2Cc1ccccn1 |
| InChI | InChI=1S/C13H10FN3OS/c14-9-5-12-11(6-10(9)15)17(13(18)19-12)7-8-3-1-2-4-16-8/h1-6H,7,15H2 |
| InChIKey | KSRTXFMVFJKLJM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|