C8H5NO3S — CID 15623072
2-(furan-2-yl)-1,3-thiazole-4-carboxylic acid (PubChem CID 15623072) has the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. Its IUPAC name is 2-(furan-2-yl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-(furan-2-yl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 15623072 |
| Molecular Formula | C8H5NO3S |
| Molecular Weight | 195.20 g/mol |
| Exact Mass | 195.00 |
| IUPAC Name | 2-(furan-2-yl)-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C8H5NO3S/c10-8(11)5-4-13-7(9-5)6-2-1-3-12-6/h1-4H,(H,10,11) |
| InChIKey | HYMZKFYFRXCTCA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |