About 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide
2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide (PubChem CID 15623145) has the molecular formula C11H13N7O3S
and a molecular weight of 323.34 g/mol. Its IUPAC name is 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 15623145 |
| Molecular Formula | C11H13N7O3S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide |
| SMILES | NCCO.O=C(Nc1nn[nH]n1)c1csc(-c2ccco2)n1 |
| InChI | InChI=1S/C9H6N6O2S.C2H7NO/c16-7(11-9-12-14-15-13-9)5-4-18-8(10-5)6-2-1-3-17-6;3-1-2-4/h1-4H,(H2,11,12,13,14,15,16);4H,1-3H2 |
| InChIKey | IBQKAYXUXDIQEJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 155.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide (CID 15623145) is 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide is NCCO.O=C(Nc1nn[nH]n1)c1csc(-c2ccco2)n1.
What is the InChIKey of 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide?
The InChIKey is IBQKAYXUXDIQEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N6O2S.C2H7NO/c16-7(11-9-12-14-15-13-9)5-4-18-8(10-5)6-2-1-3-17-6;3-1-2-4/h1-4H,(H2,11,12,13,14,15,16);4H,1-3H2.
What are the key properties of 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide?
2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide has a molecular weight of 323.34 g/mol, XLogP of 0.11, 4 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanol;2-(furan-2-yl)-N-(2H-tetrazol-5-yl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 15623145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).