C46H32F3N9 — CID 156282840
3-(4,6-Dimethyl-1,3,5-triazin-2-yl)-9-[2-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]pyridin-2-yl]-4-(trifluoromethyl)phenyl]carbazole (PubChem CID 156282840) has the molecular formula C46H32F3N9 and a molecular weight of 767.80 g/mol. Its IUPAC name is 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-pyridinyl]-4-(trifluoromethyl)phenyl]carbazole.
| Compound Name | 3-(4,6-Dimethyl-1,3,5-triazin-2-yl)-9-[2-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]pyridin-2-yl]-4-(trifluoromethyl)phenyl]carbazole |
|---|---|
| PubChem CID | 156282840 |
| Molecular Formula | C46H32F3N9 |
| Molecular Weight | 767.80 g/mol |
| Exact Mass | 767.27 |
| IUPAC Name | 3-(4,6-dimethyl-1,3,5-triazin-2-yl)-9-[2-[3-[3-(4,6-dimethyl-1,3,5-triazin-2-yl)carbazol-9-yl]-2-pyridinyl]-4-(trifluoromethyl)phenyl]carbazole |
| SMILES | CC1=NC(=NC(=N1)C2=CC3=C(C=C2)N(C4=CC=CC=C43)C5=C(N=CC=C5)C6=C(C=CC(=C6)C(F)(F)F)N7C8=C(C=C(C=C8)C9=NC(=NC(=N9)C)C)C1=CC=CC=C17)C |
| InChI | InChI=1S/C46H32F3N9/c1-25-51-26(2)54-44(53-25)29-15-18-39-34(22-29)32-10-5-7-12-37(32)57(39)41-20-17-31(46(47,48)49)24-36(41)43-42(14-9-21-50-43)58-38-13-8-6-11-33(38)35-23-30(16-19-40(35)58)45-55-27(3)52-28(4)56-45/h5-24H,1-4H3 |
| InChIKey | VXMPDIYTRAOEQV-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 100.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | 1380 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.80 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |