C12H14O3 — CID 15642722
ethyl 6-acetylcyclohepta-1,3,5-triene-1-carboxylate (PubChem CID 15642722) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is ethyl 6-acetylcyclohepta-1,3,5-triene-1-carboxylate.
| Compound Name | ethyl 6-acetylcyclohepta-1,3,5-triene-1-carboxylate |
|---|---|
| PubChem CID | 15642722 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | ethyl 6-acetylcyclohepta-1,3,5-triene-1-carboxylate |
| SMILES | CCOC(=O)C1=CC=CC=C(C(C)=O)C1 |
| InChI | InChI=1S/C12H14O3/c1-3-15-12(14)11-7-5-4-6-10(8-11)9(2)13/h4-7H,3,8H2,1-2H3 |
| InChIKey | OOBRWPBTOHVMFD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |