C11H8Br2OS — CID 15647386
3,6-dibromo-4,7-dimethylthiochromen-2-one (PubChem CID 15647386) has the molecular formula C11H8Br2OS and a molecular weight of 348.06 g/mol. Its IUPAC name is 3,6-dibromo-4,7-dimethylthiochromen-2-one.
| Compound Name | 3,6-dibromo-4,7-dimethylthiochromen-2-one |
|---|---|
| PubChem CID | 15647386 |
| Molecular Formula | C11H8Br2OS |
| Molecular Weight | 348.06 g/mol |
| Exact Mass | 345.87 |
| IUPAC Name | 3,6-dibromo-4,7-dimethylthiochromen-2-one |
| SMILES | Cc1cc2sc(=O)c(Br)c(C)c2cc1Br |
| InChI | InChI=1S/C11H8Br2OS/c1-5-3-9-7(4-8(5)12)6(2)10(13)11(14)15-9/h3-4H,1-2H3 |
| InChIKey | PUSAEJRWBBSRLE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.06 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |