C26H31N5O4 — CID 156500770
3-[6-[[1-[[2-(methylamino)-3-pyridinyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156500770) has the molecular formula C26H31N5O4 and a molecular weight of 477.57 g/mol. Its IUPAC name is 3-[6-[[1-[[2-(methylamino)-3-pyridinyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[1-[[2-(methylamino)-3-pyridinyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156500770 |
| Molecular Formula | C26H31N5O4 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 3-[6-[[1-[[2-(methylamino)-3-pyridinyl]methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CNc1ncccc1CN1CCCCC1COc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C26H31N5O4/c1-27-24-17(5-4-11-28-24)14-30-12-3-2-6-19(30)16-35-20-7-8-21-18(13-20)15-31(26(21)34)22-9-10-23(32)29-25(22)33/h4-5,7-8,11,13,19,22H,2-3,6,9-10,12,14-16H2,1H3,(H,27,28)(H,29,32,33) |
| InChIKey | AIWHAVFIOWAVBF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|