C30H37N3O4 — CID 156501107
3-[6-[[(2R)-1-[(4-tert-butylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 156501107) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is 3-[6-[[(2R)-1-[(4-tert-butylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[(2R)-1-[(4-tert-butylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 156501107 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 3-[6-[[(2R)-1-[(4-tert-butylphenyl)methyl]piperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC(C)(C)c1ccc(CN2CCCC[C@@H]2COc2ccc3c(c2)CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C30H37N3O4/c1-30(2,3)22-9-7-20(8-10-22)17-32-15-5-4-6-23(32)19-37-24-11-12-25-21(16-24)18-33(29(25)36)26-13-14-27(34)31-28(26)35/h7-12,16,23,26H,4-6,13-15,17-19H2,1-3H3,(H,31,34,35)/t23-,26?/m1/s1 |
| InChIKey | CUWBODTYPCOOML-GEPVFLLWSA-N |
| XLogP | 4.18 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|