C24H13F3N2O3S2 — CID 156501468
[4-(20-thia-3,10-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-11-yl)phenyl] trifluoromethanesulfonate (PubChem CID 156501468) has the molecular formula C24H13F3N2O3S2 and a molecular weight of 498.51 g/mol. Its IUPAC name is [4-(20-thia-3,10-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-11-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-(20-thia-3,10-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-11-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 156501468 |
| Molecular Formula | C24H13F3N2O3S2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | [4-(20-thia-3,10-diazapentacyclo[11.7.0.02,10.04,9.014,19]icosa-1(13),2,4,6,8,11,14,16,18-nonaen-11-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cc3c4ccccc4sc3c3nc4ccccc4n23)cc1)C(F)(F)F |
| InChI | InChI=1S/C24H13F3N2O3S2/c25-24(26,27)34(30,31)32-15-11-9-14(10-12-15)20-13-17-16-5-1-4-8-21(16)33-22(17)23-28-18-6-2-3-7-19(18)29(20)23/h1-13H |
| InChIKey | HMIRDQXCKAYKBZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|