C18H12N4O2 — CID 156503118
4-(6-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)benzoic acid (PubChem CID 156503118) has the molecular formula C18H12N4O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 4-(6-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)benzoic acid.
| Compound Name | 4-(6-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 156503118 |
| Molecular Formula | C18H12N4O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(6-phenyl-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2nnc3cnc(-c4ccccc4)cn23)cc1 |
| InChI | InChI=1S/C18H12N4O2/c23-18(24)14-8-6-13(7-9-14)17-21-20-16-10-19-15(11-22(16)17)12-4-2-1-3-5-12/h1-11H,(H,23,24) |
| InChIKey | JOTGNTCDOCWEAT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |