C17H23N3O2S — CID 156503706
4-[2-(2-aminoanilino)propan-2-yl]-N,N-dimethylbenzenesulfonamide (PubChem CID 156503706) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 4-[2-(2-aminoanilino)propan-2-yl]-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-[2-(2-aminoanilino)propan-2-yl]-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 156503706 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 4-[2-(2-aminoanilino)propan-2-yl]-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(C)(C)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-17(2,19-16-8-6-5-7-15(16)18)13-9-11-14(12-10-13)23(21,22)20(3)4/h5-12,19H,18H2,1-4H3 |
| InChIKey | WILDFRCOZTXOAJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|