C19H29FN2O3 — CID 156505929
tert-butyl 2-[(2S,6R)-1-(4-amino-2-fluorophenyl)-4-hydroxy-2,6-dimethylpiperidin-4-yl]acetate (PubChem CID 156505929) has the molecular formula C19H29FN2O3 and a molecular weight of 352.45 g/mol. Its IUPAC name is tert-butyl 2-[(2S,6R)-1-(4-amino-2-fluorophenyl)-4-hydroxy-2,6-dimethylpiperidin-4-yl]acetate.
| Compound Name | tert-butyl 2-[(2S,6R)-1-(4-amino-2-fluorophenyl)-4-hydroxy-2,6-dimethylpiperidin-4-yl]acetate |
|---|---|
| PubChem CID | 156505929 |
| Molecular Formula | C19H29FN2O3 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | tert-butyl 2-[(2S,6R)-1-(4-amino-2-fluorophenyl)-4-hydroxy-2,6-dimethylpiperidin-4-yl]acetate |
| SMILES | C[C@@H]1CC(O)(CC(=O)OC(C)(C)C)C[C@H](C)N1c1ccc(N)cc1F |
| InChI | InChI=1S/C19H29FN2O3/c1-12-9-19(24,11-17(23)25-18(3,4)5)10-13(2)22(12)16-7-6-14(21)8-15(16)20/h6-8,12-13,24H,9-11,21H2,1-5H3/t12-,13+,19? |
| InChIKey | HLSSIWALAKMPDT-ZHZUQJFRSA-N |
| XLogP | 3.25 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|