4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid

C9H17NO4 — CID 156506776

IUPAC4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid
SMILESO=C(O)N1CCC(C[C@H](O)CO)CC1
InChIInChI=1S/C9H17NO4/c11-6-8(12)5-7-1-3-10(4-2-7)9(13)14/h7-8,11-12H,1-6H2,(H,13,14)/t8-/m0/s1
InChIKeyGAOQASAFNYPQKU-QMMMGPOBSA-N
MW203.24 g/mol
LogP0.12
Rot. Bonds3

About 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid

4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid (PubChem CID 156506776) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid.

Molecular Properties

Compound Name4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid
PubChem CID156506776
Molecular FormulaC9H17NO4
Molecular Weight203.24 g/mol
Exact Mass203.12
IUPAC Name4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid
SMILESO=C(O)N1CCC(C[C@H](O)CO)CC1
InChIInChI=1S/C9H17NO4/c11-6-8(12)5-7-1-3-10(4-2-7)9(13)14/h7-8,11-12H,1-6H2,(H,13,14)/t8-/m0/s1
InChIKeyGAOQASAFNYPQKU-QMMMGPOBSA-N
XLogP0.12
TPSA81.00 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.24
LogP ≤ 50.12
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid?
The IUPAC name of 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid (CID 156506776) is 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid.
What is the SMILES notation for 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid?
The canonical SMILES for 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid is O=C(O)N1CCC(C[C@H](O)CO)CC1.
What is the InChIKey of 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid?
The InChIKey is GAOQASAFNYPQKU-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H17NO4/c11-6-8(12)5-7-1-3-10(4-2-7)9(13)14/h7-8,11-12H,1-6H2,(H,13,14)/t8-/m0/s1.
What are the key properties of 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid?
4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid has a molecular weight of 203.24 g/mol, XLogP of 0.12, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S)-2,3-dihydroxypropyl]piperidine-1-carboxylic acid is sourced from PubChem (CID 156506776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).