C9H17NO4 — CID 68759598
4-(2,3-dihydroxypropyl)piperidine-1-carboxylic acid (PubChem CID 68759598) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-(2,3-dihydroxypropyl)piperidine-1-carboxylic acid.
| Compound Name | 4-(2,3-dihydroxypropyl)piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 68759598 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 4-(2,3-dihydroxypropyl)piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(CC(O)CO)CC1 |
| InChI | InChI=1S/C9H17NO4/c11-6-8(12)5-7-1-3-10(4-2-7)9(13)14/h7-8,11-12H,1-6H2,(H,13,14) |
| InChIKey | GAOQASAFNYPQKU-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |