C60H42N6 — CID 156511407
3,5-bis(2,6-diphenylpyrimidin-4-yl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile (PubChem CID 156511407) has the molecular formula C60H42N6 and a molecular weight of 847.04 g/mol. Its IUPAC name is 3,5-bis(2,6-diphenylpyrimidin-4-yl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile.
| Compound Name | 3,5-bis(2,6-diphenylpyrimidin-4-yl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 156511407 |
| Molecular Formula | C60H42N6 |
| Molecular Weight | 847.04 g/mol |
| Exact Mass | 846.35 |
| IUPAC Name | 3,5-bis(2,6-diphenylpyrimidin-4-yl)-4-[3-(2,4,6-trimethylphenyl)carbazol-9-yl]benzonitrile |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)c2ccccc2n3-c2c(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)cc(C#N)cc2-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c(C)c1 |
| InChI | InChI=1S/C60H42N6/c1-38-30-39(2)57(40(3)31-38)46-28-29-56-48(34-46)47-26-16-17-27-55(47)66(56)58-49(53-35-51(42-18-8-4-9-19-42)62-59(64-53)44-22-12-6-13-23-44)32-41(37-61)33-50(58)54-36-52(43-20-10-5-11-21-43)63-60(65-54)45-24-14-7-15-25-45/h4-36H,1-3H3 |
| InChIKey | ZQZYCCALKHIAPS-UHFFFAOYSA-N |
| XLogP | 14.83 |
| TPSA | 80.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.04 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |