C31H35ClN6OS — CID 156512537
1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-5-methyl-3-(4-thiomorpholin-4-ylphenyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one (PubChem CID 156512537) has the molecular formula C31H35ClN6OS and a molecular weight of 575.18 g/mol. Its IUPAC name is 1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-5-methyl-3-(4-thiomorpholin-4-ylphenyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-5-methyl-3-(4-thiomorpholin-4-ylphenyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156512537 |
| Molecular Formula | C31H35ClN6OS |
| Molecular Weight | 575.18 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-5-methyl-3-(4-thiomorpholin-4-ylphenyl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)cc(C)c(Cl)c1-c1c(-c2ccc(N3CCSCC3)cc2)nn(C2CC3(C2)CN(C(=O)C=C)C3)c1C |
| InChI | InChI=1S/C31H35ClN6OS/c1-4-26(39)37-17-31(18-37)14-23(15-31)38-20(3)27(28-24(16-33)25(34)13-19(2)29(28)32)30(35-38)21-5-7-22(8-6-21)36-9-11-40-12-10-36/h4-8,13,16,23,33H,1,9-12,14-15,17-18,34H2,2-3H3/b33-16+ |
| InChIKey | DPLUBCQHNNINPL-MHDJOFBISA-N |
| XLogP | 5.97 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.18 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|