C30H42ClN7O2 — CID 166543520
acetaldehyde;1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-3-(2-ethyl-4-methylpiperazin-1-yl)-5-methylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one (PubChem CID 166543520) has the molecular formula C30H42ClN7O2 and a molecular weight of 568.17 g/mol. Its IUPAC name is acetaldehyde;1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-3-(2-ethyl-4-methylpiperazin-1-yl)-5-methylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one.
| Compound Name | acetaldehyde;1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-3-(2-ethyl-4-methylpiperazin-1-yl)-5-methylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166543520 |
| Molecular Formula | C30H42ClN7O2 |
| Molecular Weight | 568.17 g/mol |
| Exact Mass | 567.31 |
| IUPAC Name | acetaldehyde;1-[6-[4-(5-amino-2-chloro-6-methanimidoyl-3-methylphenyl)-3-(2-ethyl-4-methylpiperazin-1-yl)-5-methylpyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one |
| SMILES | CC=O.[H]/N=C/c1c(N)cc(C)c(Cl)c1-c1c(N2CCN(C)CC2CC)nn(C2CC3(C2)CN(C(=O)C=C)C3)c1C |
| InChI | InChI=1S/C28H38ClN7O.C2H4O/c1-6-19-14-33(5)8-9-35(19)27-24(25-21(13-30)22(31)10-17(3)26(25)29)18(4)36(32-27)20-11-28(12-20)15-34(16-28)23(37)7-2;1-2-3/h7,10,13,19-20,30H,2,6,8-9,11-12,14-16,31H2,1,3-5H3;2H,1H3/b30-13+; |
| InChIKey | MCJVUZASOXZXOI-KNZOYEIVSA-N |
| XLogP | 4.49 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.17 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|