C12H24N2 — CID 156516446
N,1-ditert-butylpyrrolidin-2-imine (PubChem CID 156516446) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is N,1-ditert-butylpyrrolidin-2-imine.
| Compound Name | N,1-ditert-butylpyrrolidin-2-imine |
|---|---|
| PubChem CID | 156516446 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | N,1-ditert-butylpyrrolidin-2-imine |
| SMILES | CC(C)(C)/N=C1\CCCN1C(C)(C)C |
| InChI | InChI=1S/C12H24N2/c1-11(2,3)13-10-8-7-9-14(10)12(4,5)6/h7-9H2,1-6H3/b13-10+ |
| InChIKey | UYIVFDSGLFJTFJ-JLHYYAGUSA-N |
| XLogP | 3.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|