C32H35FN6O8S — CID 156517408
2-[[1-[(2,6-dioxopiperidin-3-yl)amino]-2-phenoxybut-3-enyl]-propylamino]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide (PubChem CID 156517408) has the molecular formula C32H35FN6O8S and a molecular weight of 682.73 g/mol. Its IUPAC name is 2-[[1-[(2,6-dioxopiperidin-3-yl)amino]-2-phenoxybut-3-enyl]-propylamino]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide.
| Compound Name | 2-[[1-[(2,6-dioxopiperidin-3-yl)amino]-2-phenoxybut-3-enyl]-propylamino]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 156517408 |
| Molecular Formula | C32H35FN6O8S |
| Molecular Weight | 682.73 g/mol |
| Exact Mass | 682.22 |
| IUPAC Name | 2-[[1-[(2,6-dioxopiperidin-3-yl)amino]-2-phenoxybut-3-enyl]-propylamino]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide |
| SMILES | C=CC(Oc1ccccc1)C(NC1CCC(=O)NC1=O)N(CCC)CC(=O)Nc1ccc2c(F)c(N3CC(=O)NS3(=O)=O)c(O)cc2c1 |
| InChI | InChI=1S/C32H35FN6O8S/c1-3-14-38(31(35-23-12-13-26(41)36-32(23)44)25(4-2)47-21-8-6-5-7-9-21)17-27(42)34-20-10-11-22-19(15-20)16-24(40)30(29(22)33)39-18-28(43)37-48(39,45)46/h4-11,15-16,23,25,31,35,40H,2-3,12-14,17-18H2,1H3,(H,34,42)(H,37,43)(H,36,41,44) |
| InChIKey | YGBMFIRLFIUPFK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 186.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.73 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|