C32H29FN8O7S — CID 166549537
2-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,5-dimethylpyrazol-1-yl]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide (PubChem CID 166549537) has the molecular formula C32H29FN8O7S and a molecular weight of 688.70 g/mol. Its IUPAC name is 2-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,5-dimethylpyrazol-1-yl]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide.
| Compound Name | 2-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,5-dimethylpyrazol-1-yl]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 166549537 |
| Molecular Formula | C32H29FN8O7S |
| Molecular Weight | 688.70 g/mol |
| Exact Mass | 688.19 |
| IUPAC Name | 2-[4-[3-(2,6-dioxopiperidin-3-yl)-1-methylindazol-6-yl]-3,5-dimethylpyrazol-1-yl]-N-[5-fluoro-7-hydroxy-6-(1,1,4-trioxo-1,2,5-thiadiazolidin-2-yl)naphthalen-2-yl]acetamide |
| SMILES | Cc1nn(CC(=O)Nc2ccc3c(F)c(N4CC(=O)NS4(=O)=O)c(O)cc3c2)c(C)c1-c1ccc2c(C3CCC(=O)NC3=O)nn(C)c2c1 |
| InChI | InChI=1S/C32H29FN8O7S/c1-15-28(17-4-6-21-23(11-17)39(3)37-30(21)22-8-9-25(43)35-32(22)46)16(2)40(36-15)13-26(44)34-19-5-7-20-18(10-19)12-24(42)31(29(20)33)41-14-27(45)38-49(41,47)48/h4-7,10-12,22,42H,8-9,13-14H2,1-3H3,(H,34,44)(H,38,45)(H,35,43,46) |
| InChIKey | RAXYPQHEUSMONM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 197.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.70 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|