C21H23F3N3O2+ — CID 156518203
trimethyl-[2-[3-[2-[4-(trifluoromethyl)anilino]-1,3-oxazol-5-yl]phenoxy]ethyl]azanium (PubChem CID 156518203) has the molecular formula C21H23F3N3O2+ and a molecular weight of 406.43 g/mol. Its IUPAC name is trimethyl-[2-[3-[2-[4-(trifluoromethyl)anilino]-1,3-oxazol-5-yl]phenoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[3-[2-[4-(trifluoromethyl)anilino]-1,3-oxazol-5-yl]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 156518203 |
| Molecular Formula | C21H23F3N3O2+ |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | trimethyl-[2-[3-[2-[4-(trifluoromethyl)anilino]-1,3-oxazol-5-yl]phenoxy]ethyl]azanium |
| SMILES | C[N+](C)(C)CCOc1cccc(-c2cnc(Nc3ccc(C(F)(F)F)cc3)o2)c1 |
| InChI | InChI=1S/C21H23F3N3O2/c1-27(2,3)11-12-28-18-6-4-5-15(13-18)19-14-25-20(29-19)26-17-9-7-16(8-10-17)21(22,23)24/h4-10,13-14H,11-12H2,1-3H3,(H,25,26)/q+1 |
| InChIKey | UULPRIOFHGVMFO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|