C24H30N4O2 — CID 18439698
N-[4-(4-methylpiperazin-1-yl)phenyl]-5-[3-(2-methylpropoxy)phenyl]-1,3-oxazol-2-amine (PubChem CID 18439698) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-5-[3-(2-methylpropoxy)phenyl]-1,3-oxazol-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-[3-(2-methylpropoxy)phenyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 18439698 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-5-[3-(2-methylpropoxy)phenyl]-1,3-oxazol-2-amine |
| SMILES | CC(C)COc1cccc(-c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)o2)c1 |
| InChI | InChI=1S/C24H30N4O2/c1-18(2)17-29-22-6-4-5-19(15-22)23-16-25-24(30-23)26-20-7-9-21(10-8-20)28-13-11-27(3)12-14-28/h4-10,15-16,18H,11-14,17H2,1-3H3,(H,25,26) |
| InChIKey | BSQXLWDBXSCKRO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|