C24H23N3O3 — CID 24801484
7-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine (PubChem CID 24801484) has the molecular formula C24H23N3O3 and a molecular weight of 401.47 g/mol. Its IUPAC name is 7-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine.
| Compound Name | 7-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 24801484 |
| Molecular Formula | C24H23N3O3 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | 7-(3-methoxyphenyl)-N-(4-morpholin-4-ylphenyl)-1,3-benzoxazol-2-amine |
| SMILES | COc1cccc(-c2cccc3nc(Nc4ccc(N5CCOCC5)cc4)oc23)c1 |
| InChI | InChI=1S/C24H23N3O3/c1-28-20-5-2-4-17(16-20)21-6-3-7-22-23(21)30-24(26-22)25-18-8-10-19(11-9-18)27-12-14-29-15-13-27/h2-11,16H,12-15H2,1H3,(H,25,26) |
| InChIKey | APGGPVMPCVNXNX-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|