C25H25N5O3 — CID 171348432
3-[2-(3-methoxy-4-piperazin-1-ylanilino)-1,3-benzoxazol-7-yl]benzamide (PubChem CID 171348432) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is 3-[2-(3-methoxy-4-piperazin-1-ylanilino)-1,3-benzoxazol-7-yl]benzamide.
| Compound Name | 3-[2-(3-methoxy-4-piperazin-1-ylanilino)-1,3-benzoxazol-7-yl]benzamide |
|---|---|
| PubChem CID | 171348432 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 3-[2-(3-methoxy-4-piperazin-1-ylanilino)-1,3-benzoxazol-7-yl]benzamide |
| SMILES | COc1cc(Nc2nc3cccc(-c4cccc(C(N)=O)c4)c3o2)ccc1N1CCNCC1 |
| InChI | InChI=1S/C25H25N5O3/c1-32-22-15-18(8-9-21(22)30-12-10-27-11-13-30)28-25-29-20-7-3-6-19(23(20)33-25)16-4-2-5-17(14-16)24(26)31/h2-9,14-15,27H,10-13H2,1H3,(H2,26,31)(H,28,29) |
| InChIKey | CIDBZYFDDUYYLH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|